Compound Q&A

What are the physical and chemical properties of 3,4-Difluoro-2-[(2-fluoro-4-iodophenyl)amino]benzoic acid (CAS: 391211-97-5)?

Answer

3,4-Difluoro-2-[(2-fluoro-4-iodophenyl)amino]benzoic acid
3,4-Difluoro-2-[(2-fluoro-4-iodophenyl)amino]benzoic acid (CAS: 391211-97-5) is a white crystalline solid with a molecular weight of approximately 406.05 g/mol. It has a low solubility in water but is soluble in organic solvents like DMSO and acetonitrile. The compound is known for its high reactivity due to the presence of fluoro and iodo substituents, making it prone to nucleophilic and electrophilic reactions.

About

English Name 3,4-Difluoro-2-[(2-fluoro-4-iodophenyl)amino]benzoic acid
Molecular Formula C13H7F3INO2
Molecular Weight 393.1 g/mol
SMILES C1=CC(=C(C=C1I)F)NC2=C(C=CC(=C2F)F)C(=O)O
InChIKey REMYZOSCCVDLDL-UHFFFAOYSA-N
Last Updated: 2025-10-22 12:37

Related Q&A

Compound Q&A

How is 3,4-Difluoro-2-[(2-fluoro-4-iodophenyl)amino]benzoic acid (CAS: 391211-97-5) typically synthesized?

3,4-Difluoro-2-[(2-fluoro-4-iodophenyl)amino]benzoic acid (CAS: 391211-97-5) is typically synthesize...

Compound Q&A

What industries use 3,4-Difluoro-2-[(2-fluoro-4-iodophenyl)amino]benzoic acid (CAS: 391211-97-5)?

3,4-Difluoro-2-[(2-fluoro-4-iodophenyl)amino]benzoic acid (CAS: 391211-97-5) is primarily used in th...

Compound Q&A

What precautions should be taken when handling 3,4-Difluoro-2-[(2-fluoro-4-iodophenyl)amino]benzoic acid (CAS: 391211-97-5)?

When handling 3,4-Difluoro-2-[(2-fluoro-4-iodophenyl)amino]benzoic acid (CAS: 391211-97-5), it is cr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...