Compound Q&A

What are the main uses of Moracin M (CAS: 56317-21-6)?

Answer

Moracin M
Moracin M (CAS: 56317-21-6) is primarily used in pharmaceutical research for its bioactive properties. It is also explored in the natural products industry due to its structural complexity and potential for drug discovery. Additionally, it has applications in analytical chemistry and as a reagent in organic synthesis.

About

CAS No 56317-21-6
English Name Moracin M
Molecular Formula C14H10O4
Molecular Weight 242.23 g/mol
SMILES C1=CC2=C(C=C1O)OC(=C2)C3=CC(=CC(=C3)O)O
InChIKey LHPRYOJTASOZGJ-UHFFFAOYSA-N
Last Updated: 2025-10-22 00:41

Related Q&A

Compound Q&A

What is Moracin M (CAS: 56317-21-6)?

Moracin M (CAS: 56317-21-6) is a cyclic dimeric coumarin derivative with unique structural features....

Compound Q&A

Is Moracin M (CAS: 56317-21-6) safe?

Moracin M (CAS: 56317-21-6) is generally safe when handled with appropriate precautions. Users shoul...

Compound Q&A

How should Moracin M (CAS: 56317-21-6) be stored?

Moracin M (CAS: 56317-21-6) should be stored in a cool, dry place, away from direct sunlight and hea...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...