Compound Q&A

What is Moracin M (CAS: 56317-21-6)?

Answer

Moracin M
Moracin M (CAS: 56317-21-6) is a cyclic dimeric coumarin derivative with unique structural features. It is characterized by its high stability and specific UV absorption. Moracin M exhibits potent bioactivity and is used in various applications including pharmaceuticals and natural product chemistry.

About

CAS No 56317-21-6
English Name Moracin M
Molecular Formula C14H10O4
Molecular Weight 242.23 g/mol
SMILES C1=CC2=C(C=C1O)OC(=C2)C3=CC(=CC(=C3)O)O
InChIKey LHPRYOJTASOZGJ-UHFFFAOYSA-N
Last Updated: 2025-10-22 00:41

Related Q&A

Compound Q&A

What are the main uses of Moracin M (CAS: 56317-21-6)?

Moracin M (CAS: 56317-21-6) is primarily used in pharmaceutical research for its bioactive propertie...

Compound Q&A

Is Moracin M (CAS: 56317-21-6) safe?

Moracin M (CAS: 56317-21-6) is generally safe when handled with appropriate precautions. Users shoul...

Compound Q&A

How should Moracin M (CAS: 56317-21-6) be stored?

Moracin M (CAS: 56317-21-6) should be stored in a cool, dry place, away from direct sunlight and hea...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...