Compound Q&A

How should 2,4,6-Tris(3-bromophenyl)-1,3,5-triazine (CAS: 890148-78-4) be stored?

Answer

2,4,6-Tris(3-bromophenyl)-1,3,5-triazine
2,4,6-Tris(3-bromophenyl)-1,3,5-triazine (CAS: 890148-78-4) should be stored in a cool, dry place away from direct light and heat sources. It should be kept in a tightly sealed container to prevent degradation and contamination. Storage should be conducted in a well-ventilated area to minimize the risk of exposure.

About

English Name 2,4,6-Tris(3-bromophenyl)-1,3,5-triazine
Molecular Formula C21H12Br3N3
Molecular Weight 546.06 g/mol
SMILES C1=CC(=CC(=C1)Br)C2=NC(=NC(=N2)C3=CC(=CC=C3)Br)C4=CC(=CC=C4)Br
InChIKey IWHHYACTSSPXDV-UHFFFAOYSA-N
Last Updated: 2025-10-22 00:41

Related Q&A

Compound Q&A

What is 2,4,6-Tris(3-bromophenyl)-1,3,5-triazine (CAS: 890148-78-4)?

2,4,6-Tris(3-bromophenyl)-1,3,5-triazine (CAS: 890148-78-4) is an organic compound with a complex mo...

Compound Q&A

What are the main uses of 2,4,6-Tris(3-bromophenyl)-1,3,5-triazine (CAS: 890148-78-4)?

2,4,6-Tris(3-bromophenyl)-1,3,5-triazine (CAS: 890148-78-4) is primarily used in the synthesis of ot...

Compound Q&A

Is 2,4,6-Tris(3-bromophenyl)-1,3,5-triazine (CAS: 890148-78-4) safe?

2,4,6-Tris(3-bromophenyl)-1,3,5-triazine (CAS: 890148-78-4) is generally considered safe for laborat...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...