Compound Q&A

Is 2,4,6-Tris(3-bromophenyl)-1,3,5-triazine (CAS: 890148-78-4) safe?

Answer

2,4,6-Tris(3-bromophenyl)-1,3,5-triazine
2,4,6-Tris(3-bromophenyl)-1,3,5-triazine (CAS: 890148-78-4) is generally considered safe for laboratory use when proper safety measures are followed. However, it is highly reactive and can be toxic if inhaled or ingested. Protective equipment, such as gloves and goggles, should be worn during handling.

About

English Name 2,4,6-Tris(3-bromophenyl)-1,3,5-triazine
Molecular Formula C21H12Br3N3
Molecular Weight 546.06 g/mol
SMILES C1=CC(=CC(=C1)Br)C2=NC(=NC(=N2)C3=CC(=CC=C3)Br)C4=CC(=CC=C4)Br
InChIKey IWHHYACTSSPXDV-UHFFFAOYSA-N
Last Updated: 2025-10-22 00:41

Related Q&A

Compound Q&A

What is 2,4,6-Tris(3-bromophenyl)-1,3,5-triazine (CAS: 890148-78-4)?

2,4,6-Tris(3-bromophenyl)-1,3,5-triazine (CAS: 890148-78-4) is an organic compound with a complex mo...

Compound Q&A

What are the main uses of 2,4,6-Tris(3-bromophenyl)-1,3,5-triazine (CAS: 890148-78-4)?

2,4,6-Tris(3-bromophenyl)-1,3,5-triazine (CAS: 890148-78-4) is primarily used in the synthesis of ot...

Compound Q&A

How should 2,4,6-Tris(3-bromophenyl)-1,3,5-triazine (CAS: 890148-78-4) be stored?

2,4,6-Tris(3-bromophenyl)-1,3,5-triazine (CAS: 890148-78-4) should be stored in a cool, dry place aw...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...