Compound Q&A

How should 2-Acetoxy-N,N,N-trimethyl-1-propanaminium chloride (CAS: 62-51-1) be stored?

Answer

2-Acetoxy-N,N,N-trimethyl-1-propanaminium chloride
2-Acetoxy-N,N,N-trimethyl-1-propanaminium chloride should be stored in a cool, dry place away from direct sunlight and heat sources. It should be kept in a tightly sealed container to prevent evaporation and contamination. Store it at room temperature and avoid temperatures above 30°C (86°F) to maintain its stability and safety.

About

CAS No 62-51-1
English Name 2-Acetoxy-N,N,N-trimethyl-1-propanaminium chloride
Molecular Formula C8H18ClNO2
Molecular Weight 195.69 g/mol
SMILES [Cl-].CC(C[N+](C)(C)C)OC(=O)C
InChIKey JHPHVAVFUYTVCL-UHFFFAOYSA-M
Last Updated: 2025-10-21 21:33

Related Q&A

Compound Q&A

What is 2-Acetoxy-N,N,N-trimethyl-1-propanaminium chloride (CAS: 62-51-1)?

2-Acetoxy-N,N,N-trimethyl-1-propanaminium chloride is a chemical compound with the CAS number 62-51-...

Compound Q&A

What are the main uses of 2-Acetoxy-N,N,N-trimethyl-1-propanaminium chloride (CAS: 62-51-1)?

2-Acetoxy-N,N,N-trimethyl-1-propanaminium chloride is primarily used in the pharmaceutical industry ...

Compound Q&A

Is 2-Acetoxy-N,N,N-trimethyl-1-propanaminium chloride (CAS: 62-51-1) safe?

2-Acetoxy-N,N,N-trimethyl-1-propanaminium chloride is generally considered safe when handled with ap...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...