Compound Q&A

What are the main uses of 2-Acetoxy-N,N,N-trimethyl-1-propanaminium chloride (CAS: 62-51-1)?

Answer

2-Acetoxy-N,N,N-trimethyl-1-propanaminium chloride
2-Acetoxy-N,N,N-trimethyl-1-propanaminium chloride is primarily used in the pharmaceutical industry as an intermediate for the synthesis of other compounds. It is also utilized in the textile and dye manufacturing processes for its specific chemical properties.

About

CAS No 62-51-1
English Name 2-Acetoxy-N,N,N-trimethyl-1-propanaminium chloride
Molecular Formula C8H18ClNO2
Molecular Weight 195.69 g/mol
SMILES [Cl-].CC(C[N+](C)(C)C)OC(=O)C
InChIKey JHPHVAVFUYTVCL-UHFFFAOYSA-M
Last Updated: 2025-10-21 21:33

Related Q&A

Compound Q&A

What is 2-Acetoxy-N,N,N-trimethyl-1-propanaminium chloride (CAS: 62-51-1)?

2-Acetoxy-N,N,N-trimethyl-1-propanaminium chloride is a chemical compound with the CAS number 62-51-...

Compound Q&A

Is 2-Acetoxy-N,N,N-trimethyl-1-propanaminium chloride (CAS: 62-51-1) safe?

2-Acetoxy-N,N,N-trimethyl-1-propanaminium chloride is generally considered safe when handled with ap...

Compound Q&A

How should 2-Acetoxy-N,N,N-trimethyl-1-propanaminium chloride (CAS: 62-51-1) be stored?

2-Acetoxy-N,N,N-trimethyl-1-propanaminium chloride should be stored in a cool, dry place away from d...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...