Compound Q&A

What is Amylin, human amidated (CAS: 122384-88-7)?

Answer

Amylin, human amidated
Amylin, human amidated (CAS: 122384-88-7) is a polypeptide hormone produced in the pancreas. It consists of 30 amino acids and plays a role in glucose homeostasis by inhibiting glucagon secretion and food intake. It has a molecular weight of approximately 3,300 Da and is characterized by its ability to bind to specific receptors on pancreatic beta cells and adipocytes.

About

English Name Amylin, human amidated
Molecular Formula C165H261N51O55S2
Molecular Weight 3903.3 g/mol
SMILES CCC(C)C(C(=O)NC(CC(C)C)C(=O)NC(CO)C(=O)NC(CO)C(=O)NC(C(C)O)C(=O)NC(CC(=O)N)C(=O)NC(C(C)C)C(=O)NCC(=O)NC(CO)C(=O)NC(CC(=O)N)C(=O)NC(C(C)O)C(=O)NC(CC1=CC=C(C=C1)O)C(=O)N)NC(=O)C(C)NC(=O)CNC(=O)C(CC2=CC=CC=C2)NC(=O)C(CC(=O)N)NC(=O)C(CC(=O)N)NC(=O)C(CO)NC(=O)C(CO)NC(=O)C(CC3=CN=CN3)NC(=O)C(C(C)C)NC(=O)C(CC(C)C)NC(=O)C(CC4=CC=CC=C4)NC(=O)C(CC(=O)N)NC(=O)C(C)NC(=O)C(CC(C)C)NC(=O)C(CCCNC(=N)N)NC(=O)C(CCC(=O)N)NC(=O)C(C(C)O)NC(=O)C(C)NC(=O)C5CSSCC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)N5)C(C)O)C)C(C)O)CC(=O)N)NC(=O)C(CCCCN)N
InChIKey PLOPBXQQPZYQFA-UHFFFAOYSA-N
Last Updated: 2025-10-21 21:33

Related Q&A

Compound Q&A

What are the main uses of Amylin, human amidated (CAS: 122384-88-7)?

Amylin, human amidated (CAS: 122384-88-7) is primarily used in the treatment of type 2 diabetes. It ...

Compound Q&A

Is Amylin, human amidated (CAS: 122388-7) safe?

Amylin, human amidated (CAS: 122384-88-7) is generally considered safe when used as directed under m...

Compound Q&A

How should Amylin, human amidated (CAS: 122384-88-7) be stored?

Amylin, human amidated (CAS: 122384-88-7) should be stored in a tightly sealed container at room tem...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...