Compound Q&A

What are the main uses of 2-Methyl-2-propanyl 4-formyl-1H-pyrazole-1-carboxylate (CAS: 821767-61-7)?

Answer

2-Methyl-2-propanyl 4-formyl-1H-pyrazole-1-carboxylate
2-Methyl-2-propanyl 4-formyl-1H-pyrazole-1-carboxylate (CAS: 821767-61-7) is primarily used in pharmaceutical research and development. It serves as a precursor in the synthesis of other compounds and has potential applications in the development of new drugs. Additionally, it is used in research settings for its specific chemical properties.

About

English Name 2-Methyl-2-propanyl 4-formyl-1H-pyrazole-1-carboxylate
Molecular Formula C9H12N2O3
Molecular Weight 196.21 g/mol
SMILES CC(C)(C)OC(=O)n1cc(C=O)cn1
InChIKey CVBRMQQRHHCMKV-UHFFFAOYSA-N
Last Updated: 2025-10-21 21:33

Related Q&A

Compound Q&A

What is 2-Methyl-2-propanyl 4-formyl-1H-pyrazole-1-carboxylate (CAS: 821767-61-7)?

2-Methyl-2-propanyl 4-formyl-1H-pyrazole-1-carboxylate (CAS: 821767-61-7) is a chemical compound wit...

Compound Q&A

Is 2-Methyl-2-propanyl 4-formyl-1H-pyrazole-1-carboxylate (CAS: 821767-61-7) safe?

2-Methyl-2-propanyl 4-formyl-1H-pyrazole-1-carboxylate (CAS: 821767-61-7) is generally considered sa...

Compound Q&A

How should 2-Methyl-2-propanyl 4-formyl-1H-pyrazole-1-carboxylate (CAS: 821767-61-7) be stored?

2-Methyl-2-propanyl 4-formyl-1H-pyrazole-1-carboxylate (CAS: 821767-61-7) should be stored in a cool...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...