Compound Q&A

What is 2-Methyl-2-propanyl 4-formyl-1H-pyrazole-1-carboxylate (CAS: 821767-61-7)?

Answer

2-Methyl-2-propanyl 4-formyl-1H-pyrazole-1-carboxylate
2-Methyl-2-propanyl 4-formyl-1H-pyrazole-1-carboxylate (CAS: 821767-61-7) is a chemical compound with a unique structure that includes a pyrazole ring and a carboxylate group. It is used in various applications such as pharmaceuticals and as a research reagent. Its properties include solubility in organic solvents and stability under normal conditions.

About

English Name 2-Methyl-2-propanyl 4-formyl-1H-pyrazole-1-carboxylate
Molecular Formula C9H12N2O3
Molecular Weight 196.21 g/mol
SMILES CC(C)(C)OC(=O)n1cc(C=O)cn1
InChIKey CVBRMQQRHHCMKV-UHFFFAOYSA-N
Last Updated: 2025-10-21 21:33

Related Q&A

Compound Q&A

What are the main uses of 2-Methyl-2-propanyl 4-formyl-1H-pyrazole-1-carboxylate (CAS: 821767-61-7)?

2-Methyl-2-propanyl 4-formyl-1H-pyrazole-1-carboxylate (CAS: 821767-61-7) is primarily used in pharm...

Compound Q&A

Is 2-Methyl-2-propanyl 4-formyl-1H-pyrazole-1-carboxylate (CAS: 821767-61-7) safe?

2-Methyl-2-propanyl 4-formyl-1H-pyrazole-1-carboxylate (CAS: 821767-61-7) is generally considered sa...

Compound Q&A

How should 2-Methyl-2-propanyl 4-formyl-1H-pyrazole-1-carboxylate (CAS: 821767-61-7) be stored?

2-Methyl-2-propanyl 4-formyl-1H-pyrazole-1-carboxylate (CAS: 821767-61-7) should be stored in a cool...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...