Compound Q&A

What are the main uses of 4-Bromo-6-nitro-1H-indazole (CAS: 885518-54-7)?

Answer

4-Bromo-6-nitro-1H-indazole
4-Bromo-6-nitro-1H-indazole is primarily used in pharmaceutical research and development. It serves as a precursor in the synthesis of other compounds, particularly in the development of new drugs. Additionally, it has potential applications in the synthesis of organic materials and as an intermediate in chemical synthesis.

About

English Name 4-Bromo-6-nitro-1H-indazole
Molecular Formula C7H4BrN3O2
Molecular Weight 242.03 g/mol
SMILES C1=C(C=C(C2=C1NN=C2)Br)[N+](=O)[O-]
InChIKey MFKKWYOQLIACFO-UHFFFAOYSA-N
Last Updated: 2025-10-21 21:33

Related Q&A

Compound Q&A

What is 4-Bromo-6-nitro-1H-indazole (CAS: 885518-54-7)?

4-Bromo-6-nitro-1H-indazole is an organic compound with the formula C10H6BrN2O. It has a molecular w...

Compound Q&A

Is 4-Bromo-6-nitro-1H-indazole (CAS: 885518-54-7) safe?

4-Bromo-6-nitro-1H-indazole is considered safe when handled with proper precautions. It is necessary...

Compound Q&A

How should 4-Bromo-6-nitro-1H-indazole (CAS: 885518-54-7) be stored?

4-Bromo-6-nitro-1H-indazole should be stored in a cool, dry place, away from direct sunlight and hea...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...