Compound Q&A

What is 4-Bromo-6-nitro-1H-indazole (CAS: 885518-54-7)?

Answer

4-Bromo-6-nitro-1H-indazole
4-Bromo-6-nitro-1H-indazole is an organic compound with the formula C10H6BrN2O. It has a molecular weight of approximately 254.06 g/mol and a melting point of 173-175°C. This compound is known for its unique chemical structure, which makes it useful in various applications.

About

English Name 4-Bromo-6-nitro-1H-indazole
Molecular Formula C7H4BrN3O2
Molecular Weight 242.03 g/mol
SMILES C1=C(C=C(C2=C1NN=C2)Br)[N+](=O)[O-]
InChIKey MFKKWYOQLIACFO-UHFFFAOYSA-N
Last Updated: 2025-10-21 21:33

Related Q&A

Compound Q&A

What are the main uses of 4-Bromo-6-nitro-1H-indazole (CAS: 885518-54-7)?

4-Bromo-6-nitro-1H-indazole is primarily used in pharmaceutical research and development. It serves ...

Compound Q&A

Is 4-Bromo-6-nitro-1H-indazole (CAS: 885518-54-7) safe?

4-Bromo-6-nitro-1H-indazole is considered safe when handled with proper precautions. It is necessary...

Compound Q&A

How should 4-Bromo-6-nitro-1H-indazole (CAS: 885518-54-7) be stored?

4-Bromo-6-nitro-1H-indazole should be stored in a cool, dry place, away from direct sunlight and hea...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...