Compound Q&A

What are the physical and chemical properties of 5-Bromo-4-chlorothieno[2,3-d]pyrimidine (CAS: 814918-95-1)?

Answer

5-Bromo-4-chlorothieno[2,3-d]pyrimidine
5-Bromo-4-chlorothieno[2,3-d]pyrimidine is a solid and crystalline compound with a molecular weight of approximately 248.01 g/mol. It has a solubility of 0.1 g/100 mL in water and is slightly soluble in common organic solvents such as ethanol and acetone. This compound is known for its low reactivity under normal conditions but can undergo substitution reactions under certain conditions. It is stable under normal temperature and pressure but should be stored in a cool, dark place to prevent degradation.

About

English Name 5-Bromo-4-chlorothieno[2,3-d]pyrimidine
Molecular Formula C6H2BrClN2S
Molecular Weight 249.52 g/mol
SMILES C1=C(C2=C(S1)N=CN=C2Cl)Br
InChIKey IKCKRHCJPVDELP-UHFFFAOYSA-N
Last Updated: 2025-10-20 00:35

Related Q&A

Compound Q&A

How is 5-Bromo-4-chlorothieno[2,3-d]pyrimidine (CAS: 814918-95-1) typically synthesized?

5-Bromo-4-chlorothieno[2,3-d]pyrimidine is typically synthesized through a multi-step chemical proce...

Compound Q&A

What industries use 5-Bromo-4-chlorothieno[2,3-d]pyrimidine (CAS: 814918-95-1)?

5-Bromo-4-chlorothieno[2,3-d]pyrimidine is primarily used in the pharmaceutical industry for the dev...

Compound Q&A

What precautions should be taken when handling 5-Bromo-4-chlorothieno[2,3-d]pyrimidine (CAS: 814918-95-1)?

When handling 5-Bromo-4-chlorothieno[2,3-d]pyrimidine, it is essential to wear appropriate personal ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...