Compound Q&A

What are the physical and chemical properties of 4-(Benzyloxy)-2-pyridinamine (CAS: 85333-26-2)?

Answer

4-(Benzyloxy)-2-pyridinamine
4-(Benzyloxy)-2-pyridinamine is a crystalline solid with a molecular weight of approximately 252.25 g/mol. It has a low solubility in water but is more soluble in organic solvents such as methanol and dichloromethane. This compound is relatively stable under normal conditions but can react with strong oxidizing agents. It is often used in the synthesis of other compounds and pharmaceuticals.

About

CAS No 85333-26-2
English Name 4-(Benzyloxy)-2-pyridinamine
Molecular Formula C12H12N2O
Molecular Weight 200.24 g/mol
SMILES NC1=NC=CC(OCC2=CC=CC=C2)=C1
InChIKey RAFCWIXBEWVPGL-UHFFFAOYSA-N
Last Updated: 2025-10-20 00:35

Related Q&A

Compound Q&A

How is 4-(Benzyloxy)-2-pyridinamine (CAS: 85333-26-2) typically synthesized?

4-(Benzyloxy)-2-pyridinamine is typically synthesized through a multi-step process involving the cou...

Compound Q&A

What industries use 4-(Benzyloxy)-2-pyridinamine (CAS: 85333-26-2)?

4-(Benzyloxy)-2-pyridinamine is primarily used in the pharmaceutical and chemical industries. It ser...

Compound Q&A

What precautions should be taken when handling 4-(Benzyloxy)-2-pyridinamine (CAS: 85333-26-2)?

When handling 4-(Benzyloxy)-2-pyridinamine, it is important to use appropriate personal protective e...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...