Compound Q&A

What industries use 2-Bromo-5-nitro-3-(trifluoromethyl)pyridine (CAS: 956104-42-0)?

Answer

2-Bromo-5-nitro-3-(trifluoromethyl)pyridine
2-Bromo-5-nitro-3-(trifluoromethyl)pyridine (CAS: 956104-42-0) is primarily used in the pharmaceutical industry for the synthesis of various drug intermediates. It also finds applications in the field of organic chemistry as a building block for complex molecule synthesis and in the development of new materials for electronic devices.

About

English Name 2-Bromo-5-nitro-3-(trifluoromethyl)pyridine
Molecular Formula C6H2BrF3N2O2
Molecular Weight 270.99 g/mol
SMILES C1=C(C=NC(=C1C(F)(F)F)Br)[N+](=O)[O-]
InChIKey WHTGDIMWBUVWJS-UHFFFAOYSA-N
Last Updated: 2025-10-20 00:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Bromo-5-nitro-3-(trifluoromethyl)pyridine (CAS: 956104-42-0)?

2-Bromo-5-nitro-3-(trifluoromethyl)pyridine (CAS: 956104-42-0) is a crystalline solid with a molecul...

Compound Q&A

How is 2-Bromo-5-nitro-3-(trifluoromethyl)pyridine (CAS: 956104-42-0) typically synthesized?

2-Bromo-5-nitro-3-(trifluoromethyl)pyridine is typically synthesized through bromination of 5-nitro-...

Compound Q&A

What precautions should be taken when handling 2-Bromo-5-nitro-3-(trifluoromethyl)pyridine (CAS: 956104-42-0)?

When handling 2-Bromo-5-nitro-3-(trifluoromethyl)pyridine (CAS: 956104-42-0), it is crucial to use p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...