Compound Q&A

What are the physical and chemical properties of 2-Bromo-5-nitro-3-(trifluoromethyl)pyridine (CAS: 956104-42-0)?

Answer

2-Bromo-5-nitro-3-(trifluoromethyl)pyridine
2-Bromo-5-nitro-3-(trifluoromethyl)pyridine (CAS: 956104-42-0) is a crystalline solid with a molecular weight of approximately 318.03 g/mol. It is slightly soluble in water but more soluble in organic solvents like dichloromethane and acetonitrile. This compound is known for its high reactivity, particularly towards nucleophiles and reducing agents.

About

English Name 2-Bromo-5-nitro-3-(trifluoromethyl)pyridine
Molecular Formula C6H2BrF3N2O2
Molecular Weight 270.99 g/mol
SMILES C1=C(C=NC(=C1C(F)(F)F)Br)[N+](=O)[O-]
InChIKey WHTGDIMWBUVWJS-UHFFFAOYSA-N
Last Updated: 2025-10-20 00:35

Related Q&A

Compound Q&A

How is 2-Bromo-5-nitro-3-(trifluoromethyl)pyridine (CAS: 956104-42-0) typically synthesized?

2-Bromo-5-nitro-3-(trifluoromethyl)pyridine is typically synthesized through bromination of 5-nitro-...

Compound Q&A

What industries use 2-Bromo-5-nitro-3-(trifluoromethyl)pyridine (CAS: 956104-42-0)?

2-Bromo-5-nitro-3-(trifluoromethyl)pyridine (CAS: 956104-42-0) is primarily used in the pharmaceutic...

Compound Q&A

What precautions should be taken when handling 2-Bromo-5-nitro-3-(trifluoromethyl)pyridine (CAS: 956104-42-0)?

When handling 2-Bromo-5-nitro-3-(trifluoromethyl)pyridine (CAS: 956104-42-0), it is crucial to use p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...