Compound Q&A

How is Calcium hexafluorosilicate (CAS: 16925-39-6) typically synthesized?

Answer

Calcium hexafluorosilicate
Calcium hexafluorosilicate is typically synthesized by reacting calcium fluoride with silicon tetrafluoride. The process requires careful temperature control and is often carried out under anhydrous conditions to prevent hydrolysis and the formation of hydrogen fluoride gas.

About

CAS No 16925-39-6
English Name Calcium hexafluorosilicate
Molecular Formula CaF6Si
Molecular Weight 182.15 g/mol
SMILES F[Si-2](F)(F)(F)(F)F.[Ca+2]
InChIKey CVWSBMWWVFJIBN-UHFFFAOYSA-N
Last Updated: 2025-10-20 00:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of Calcium hexafluorosilicate (CAS: 16925-39-6)?

Calcium hexafluorosilicate (CAS: 16925-39-6) is a solid, white crystalline compound with a high mole...

Compound Q&A

What industries use Calcium hexafluorosilicate (CAS: 16925-39-6)?

Calcium hexafluorosilicate (CAS: 16925-39-6) is used in the pharmaceutical industry for capsule prod...

Compound Q&A

What precautions should be taken when handling Calcium hexafluorosilicate (CAS: 16925-39-6)?

When handling Calcium hexafluorosilicate (CAS: 16925-39-6), it is essential to use personal protecti...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...