Compound Q&A

What are the physical and chemical properties of Calcium hexafluorosilicate (CAS: 16925-39-6)?

Answer

Calcium hexafluorosilicate
Calcium hexafluorosilicate (CAS: 16925-39-6) is a solid, white crystalline compound with a high molecular weight. It is insoluble in water but soluble in acid. This compound is highly reactive, particularly with moisture, leading to the release of hydrogen fluoride gas.

About

CAS No 16925-39-6
English Name Calcium hexafluorosilicate
Molecular Formula CaF6Si
Molecular Weight 182.15 g/mol
SMILES F[Si-2](F)(F)(F)(F)F.[Ca+2]
InChIKey CVWSBMWWVFJIBN-UHFFFAOYSA-N
Last Updated: 2025-10-20 00:35

Related Q&A

Compound Q&A

How is Calcium hexafluorosilicate (CAS: 16925-39-6) typically synthesized?

Calcium hexafluorosilicate is typically synthesized by reacting calcium fluoride with silicon tetraf...

Compound Q&A

What industries use Calcium hexafluorosilicate (CAS: 16925-39-6)?

Calcium hexafluorosilicate (CAS: 16925-39-6) is used in the pharmaceutical industry for capsule prod...

Compound Q&A

What precautions should be taken when handling Calcium hexafluorosilicate (CAS: 16925-39-6)?

When handling Calcium hexafluorosilicate (CAS: 16925-39-6), it is essential to use personal protecti...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...