Compound Q&A

What industries use (4-{[4-(1-Benzothiophen-2-yl)-2-pyrimidinyl]amino}phenyl)[4-(1-pyrrolidinyl)-1-piperidinyl]methanone (CAS: 873225-46-8)?

Answer

(4-{[4-(1-Benzothiophen-2-yl)-2-pyrimidinyl]amino}phenyl)[4-(1-pyrrolidinyl)-1-piperidinyl]methanone
This compound is used in the pharmaceutical industry for its potential applications in drug development. It may also find applications in the polymer industry for the development of advanced materials and in the semiconductor industry for use in organic electronic devices. Further, it can be used in sensor technology due to its unique chemical properties.

About

English Name (4-{[4-(1-Benzothiophen-2-yl)-2-pyrimidinyl]amino}phenyl)[4-(1-pyrrolidinyl)-1-piperidinyl]methanone
Molecular Formula C28H29N5OS
Molecular Weight 483.64 g/mol
SMILES O=C(N1CCC(CC1)N2CCCC2)c3ccc(Nc4nccc(n4)c5cc6ccccc6s5)cc3
InChIKey BWZJBXAPRCVCKQ-UHFFFAOYSA-N
Last Updated: 2025-10-20 00:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of (4-{[4-(1-Benzothiophen-2-yl)-2-pyrimidinyl]amino}phenyl)[4-(1-pyrrolidinyl)-1-piperidinyl]methanone (CAS: 873225-46-8)?

This compound is a crystalline solid with a molecular weight of approximately 617.77 g/mol. It has a...

Compound Q&A

How is (4-{[4-(1-Benzothiophen-2-yl)-2-pyrimidinyl]amino}phenyl)[4-(1-pyrrolidinyl)-1-piperidinyl]methanone (CAS: 873225-46-8) typically synthesized?

This compound is typically synthesized via a multistep process involving the condensation of 4-(1-be...

Compound Q&A

What precautions should be taken when handling (4-{[4-(1-Benzothiophen-2-yl)-2-pyrimidinyl]amino}phenyl)[4-(1-pyrrolidinyl)-1-piperidinyl]methanone (CAS: 873225-46-8)?

When handling this compound, it is essential to wear appropriate personal protective equipment (PPE)...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...