Compound Q&A

What are the physical and chemical properties of (4-{[4-(1-Benzothiophen-2-yl)-2-pyrimidinyl]amino}phenyl)[4-(1-pyrrolidinyl)-1-piperidinyl]methanone (CAS: 873225-46-8)?

Answer

(4-{[4-(1-Benzothiophen-2-yl)-2-pyrimidinyl]amino}phenyl)[4-(1-pyrrolidinyl)-1-piperidinyl]methanone
This compound is a crystalline solid with a molecular weight of approximately 617.77 g/mol. It has a low solubility in water but is more soluble in organic solvents like methanol and acetonitrile. It is known for its high reactivity towards nucleophiles and can undergo substitution reactions. The compound is stable under normal storage conditions but should be protected from moisture and strong oxidants.

About

English Name (4-{[4-(1-Benzothiophen-2-yl)-2-pyrimidinyl]amino}phenyl)[4-(1-pyrrolidinyl)-1-piperidinyl]methanone
Molecular Formula C28H29N5OS
Molecular Weight 483.64 g/mol
SMILES O=C(N1CCC(CC1)N2CCCC2)c3ccc(Nc4nccc(n4)c5cc6ccccc6s5)cc3
InChIKey BWZJBXAPRCVCKQ-UHFFFAOYSA-N
Last Updated: 2025-10-20 00:35

Related Q&A

Compound Q&A

How is (4-{[4-(1-Benzothiophen-2-yl)-2-pyrimidinyl]amino}phenyl)[4-(1-pyrrolidinyl)-1-piperidinyl]methanone (CAS: 873225-46-8) typically synthesized?

This compound is typically synthesized via a multistep process involving the condensation of 4-(1-be...

Compound Q&A

What industries use (4-{[4-(1-Benzothiophen-2-yl)-2-pyrimidinyl]amino}phenyl)[4-(1-pyrrolidinyl)-1-piperidinyl]methanone (CAS: 873225-46-8)?

This compound is used in the pharmaceutical industry for its potential applications in drug developm...

Compound Q&A

What precautions should be taken when handling (4-{[4-(1-Benzothiophen-2-yl)-2-pyrimidinyl]amino}phenyl)[4-(1-pyrrolidinyl)-1-piperidinyl]methanone (CAS: 873225-46-8)?

When handling this compound, it is essential to wear appropriate personal protective equipment (PPE)...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...