Compound Q&A

What industries use 5-[7-(Methylsulfonyl)-2-(4-morpholinyl)-6,7-dihydro-5H-pyrrolo[2,3-d]pyrimidin-4-yl]-2-pyrimidinamine (CAS: 1007207-67-1)?

Answer

5-[7-(Methylsulfonyl)-2-(4-morpholinyl)-6,7-dihydro-5H-pyrrolo[2,3-d]pyrimidin-4-yl]-2-pyrimidinamine
This compound is primarily used in the pharmaceutical industry, particularly in the development of antiviral and antifungal drugs. It also has potential applications in the polymer industry for the modification of materials and in sensor technology for detection of specific analytes.

About

English Name 5-[7-(Methylsulfonyl)-2-(4-morpholinyl)-6,7-dihydro-5H-pyrrolo[2,3-d]pyrimidin-4-yl]-2-pyrimidinamine
Molecular Formula C15H19N7O3S
Molecular Weight 377.43 g/mol
SMILES Nc1ncc(cn1)c1nc(nc2c1CCN2S(=O)(=O)C)N1CCOCC1
InChIKey JEGHXKRHKHPBJD-UHFFFAOYSA-N
Last Updated: 2025-10-20 00:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-[7-(Methylsulfonyl)-2-(4-morpholinyl)-6,7-dihydro-5H-pyrrolo[2,3-d]pyrimidin-4-yl]-2-pyrimidinamine (CAS: 1007207-67-1)?

This compound is a crystalline solid with a molecular weight of approximately 534.67 g/mol. It has g...

Compound Q&A

How is 5-[7-(Methylsulfonyl)-2-(4-morpholinyl)-6,7-dihydro-5H-pyrrolo[2,3-d]pyrimidin-4-yl]-2-pyrimidinamine (CAS: 1007207-67-1) typically synthesized?

This compound is typically synthesized via a multistep process involving the coupling of a 4-morphol...

Compound Q&A

What precautions should be taken when handling 5-[7-(Methylsulfonyl)-2-(4-morpholinyl)-6,7-dihydro-5H-pyrrolo[2,3-d]pyrimidin-4-yl]-2-pyrimidinamine (CAS: 1007207-67-1)?

Proper personal protective equipment (PPE) such as gloves, goggles, and a lab coat should be worn wh...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...