Compound Q&A

How is 5-[7-(Methylsulfonyl)-2-(4-morpholinyl)-6,7-dihydro-5H-pyrrolo[2,3-d]pyrimidin-4-yl]-2-pyrimidinamine (CAS: 1007207-67-1) typically synthesized?

Answer

5-[7-(Methylsulfonyl)-2-(4-morpholinyl)-6,7-dihydro-5H-pyrrolo[2,3-d]pyrimidin-4-yl]-2-pyrimidinamine
This compound is typically synthesized via a multistep process involving the coupling of a 4-morpholinyl derivative with a 7-(methylsulfonyl)-6,7-dihydro-5H-pyrrolo[2,3-d]pyrimidin-4-ylamine, followed by pyrimidine condensation. The reaction is catalyzed by a phase-transfer catalyst such as tetrabutylammonium fluoride, and it proceeds with good yield and selectivity under anhydrous and inert conditions.

About

English Name 5-[7-(Methylsulfonyl)-2-(4-morpholinyl)-6,7-dihydro-5H-pyrrolo[2,3-d]pyrimidin-4-yl]-2-pyrimidinamine
Molecular Formula C15H19N7O3S
Molecular Weight 377.43 g/mol
SMILES Nc1ncc(cn1)c1nc(nc2c1CCN2S(=O)(=O)C)N1CCOCC1
InChIKey JEGHXKRHKHPBJD-UHFFFAOYSA-N
Last Updated: 2025-10-20 00:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-[7-(Methylsulfonyl)-2-(4-morpholinyl)-6,7-dihydro-5H-pyrrolo[2,3-d]pyrimidin-4-yl]-2-pyrimidinamine (CAS: 1007207-67-1)?

This compound is a crystalline solid with a molecular weight of approximately 534.67 g/mol. It has g...

Compound Q&A

What industries use 5-[7-(Methylsulfonyl)-2-(4-morpholinyl)-6,7-dihydro-5H-pyrrolo[2,3-d]pyrimidin-4-yl]-2-pyrimidinamine (CAS: 1007207-67-1)?

This compound is primarily used in the pharmaceutical industry, particularly in the development of a...

Compound Q&A

What precautions should be taken when handling 5-[7-(Methylsulfonyl)-2-(4-morpholinyl)-6,7-dihydro-5H-pyrrolo[2,3-d]pyrimidin-4-yl]-2-pyrimidinamine (CAS: 1007207-67-1)?

Proper personal protective equipment (PPE) such as gloves, goggles, and a lab coat should be worn wh...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...