Compound Q&A

What are the physical and chemical properties of Onalespib (CAS: 912999-49-6)?

Answer

Onalespib
Onalespib is a small molecule with a molecular weight of approximately 309.15 g/mol. It is poorly water-soluble and exhibits poor solubility in common organic solvents. Onalespib is a crystalline solid under normal conditions. Its stability is influenced by acidic and basic conditions, and it is reactive towards nucleophiles. It is not typically flammable but requires careful handling due to its reactivity.

About

English Name Onalespib
Molecular Formula C24H31N3O3
Molecular Weight 409.53 g/mol
SMILES CC(C)C1=CC(=C(C=C1O)O)C(=O)N2CC3=C(C2)C=C(C=C3)CN4CCN(CC4)C
InChIKey IFRGXKKQHBVPCQ-UHFFFAOYSA-N
Last Updated: 2025-10-20 00:35

Related Q&A

Compound Q&A

How is Onalespib (CAS: 912999-49-6) typically synthesized?

Onalespib is synthesized through a multi-step process involving coupling reactions, alkylation, and ...

Compound Q&A

What industries use Onalespib (CAS: 912999-49-6)?

Onalespib is primarily used in the pharmaceutical industry for research purposes, particularly in th...

Compound Q&A

What precautions should be taken when handling Onalespib (CAS: 912999-49-6)?

When handling Onalespib, proper personal protective equipment (PPE) such as gloves, goggles, and a l...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...