Compound Q&A

What precautions should be taken when handling P5091 (CAS: 882257-11-6)?

Answer

P5091
When handling P5091 (CAS: 882257-11-6), it is essential to use appropriate personal protective equipment (PPE) such as gloves and eye protection. Store the compound in a cool, dry place away from direct sunlight and flammable materials. Use a fume hood during operation to minimize inhalation risks. Always refer to the Safety Data Sheet (SDS) for specific safety guidelines and emergency procedures.

About

English Name P5091
Molecular Formula C12H7Cl2NO3S2
Molecular Weight 348.22 g/mol
SMILES CC(=O)C1=CC(=C(S1)SC2=C(C(=CC=C2)Cl)Cl)[N+](=O)[O-]
InChIKey LKZLGMAAKNEGCH-UHFFFAOYSA-N
Last Updated: 2025-10-20 00:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of P5091 (CAS: 882257-11-6)?

P5091 (CAS: 882257-11-6) is a crystalline compound with a molecular weight of approximately 257 g/mo...

Compound Q&A

How is P5091 (CAS: 882257-11-6) typically synthesized?

P5091 (CAS: 882257-11-6) is synthesized through a multistep process involving the reaction of 2,3-di...

Compound Q&A

What industries use P5091 (CAS: 882257-11-6)?

P5091 (CAS: 882257-11-6) is primarily used in the pharmaceutical industry as an intermediate for the...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...