Compound Q&A

How is P5091 (CAS: 882257-11-6) typically synthesized?

Answer

P5091
P5091 (CAS: 882257-11-6) is synthesized through a multistep process involving the reaction of 2,3-dimethoxybenzaldehyde with methyl acetoacetate. The synthesis typically requires a catalyst such as p-toluenesulfonic acid and occurs under mild conditions. The product shows high selectivity and yield, making it a valuable intermediate in organic synthesis.

About

English Name P5091
Molecular Formula C12H7Cl2NO3S2
Molecular Weight 348.22 g/mol
SMILES CC(=O)C1=CC(=C(S1)SC2=C(C(=CC=C2)Cl)Cl)[N+](=O)[O-]
InChIKey LKZLGMAAKNEGCH-UHFFFAOYSA-N
Last Updated: 2025-10-20 00:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of P5091 (CAS: 882257-11-6)?

P5091 (CAS: 882257-11-6) is a crystalline compound with a molecular weight of approximately 257 g/mo...

Compound Q&A

What industries use P5091 (CAS: 882257-11-6)?

P5091 (CAS: 882257-11-6) is primarily used in the pharmaceutical industry as an intermediate for the...

Compound Q&A

What precautions should be taken when handling P5091 (CAS: 882257-11-6)?

When handling P5091 (CAS: 882257-11-6), it is essential to use appropriate personal protective equip...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...