Compound Q&A

How is 5-(4-Chlorophenyl)-1H-pyrrolo[2,3-B]pyridine (CAS: 918516-27-5) typically synthesized?

Answer

5-(4-Chlorophenyl)-1H-pyrrolo[2,3-B]pyridine
5-(4-Chlorophenyl)-1H-pyrrolo[2,3-B]pyridine is typically synthesized via the chlorination of 1-(4-chlorophenyl)-1H-pyrrolo[2,3-b]pyridin-5(4H)-one. This process involves the use of a Lewis acid catalyst, such as aluminum chloride, in a suitable solvent like dichloromethane. The reaction is sensitive to temperature and requires careful control to achieve high yield and selectivity.

About

English Name 5-(4-Chlorophenyl)-1H-pyrrolo[2,3-B]pyridine
Molecular Formula C13H9ClN2
Molecular Weight 228.68200000000002 g/mol
SMILES C1=CC(=CC=C1C2=CN=C3C(=C2)C=CN3)Cl
InChIKey AIRHBAXIGSQPNX-UHFFFAOYSA-N
Last Updated: 2025-10-20 00:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-(4-Chlorophenyl)-1H-pyrrolo[2,3-B]pyridine (CAS: 918516-27-5)?

5-(4-Chlorophenyl)-1H-pyrrolo[2,3-B]pyridine is a crystalline solid with a molecular weight of appro...

Compound Q&A

What industries use 5-(4-Chlorophenyl)-1H-pyrrolo[2,3-B]pyridine (CAS: 918516-27-5)?

5-(4-Chlorophenyl)-1H-pyrrolo[2,3-B]pyridine is primarily used in the pharmaceutical industry as an ...

Compound Q&A

What precautions should be taken when handling 5-(4-Chlorophenyl)-1H-pyrrolo[2,3-B]pyridine (CAS: 918516-27-5)?

When handling 5-(4-Chlorophenyl)-1H-pyrrolo[2,3-B]pyridine, it is essential to use proper personal p...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...