Compound Q&A

What are the physical and chemical properties of 5-(4-Chlorophenyl)-1H-pyrrolo[2,3-B]pyridine (CAS: 918516-27-5)?

Answer

5-(4-Chlorophenyl)-1H-pyrrolo[2,3-B]pyridine
5-(4-Chlorophenyl)-1H-pyrrolo[2,3-B]pyridine is a crystalline solid with a molecular weight of approximately 241.17 g/mol. It is slightly soluble in water but more soluble in organic solvents such as ethanol and acetone. The compound is moderately reactive, particularly towards nucleophiles and bases, and it tends to undergo substitution reactions under certain conditions.

About

English Name 5-(4-Chlorophenyl)-1H-pyrrolo[2,3-B]pyridine
Molecular Formula C13H9ClN2
Molecular Weight 228.68200000000002 g/mol
SMILES C1=CC(=CC=C1C2=CN=C3C(=C2)C=CN3)Cl
InChIKey AIRHBAXIGSQPNX-UHFFFAOYSA-N
Last Updated: 2025-10-20 00:35

Related Q&A

Compound Q&A

How is 5-(4-Chlorophenyl)-1H-pyrrolo[2,3-B]pyridine (CAS: 918516-27-5) typically synthesized?

5-(4-Chlorophenyl)-1H-pyrrolo[2,3-B]pyridine is typically synthesized via the chlorination of 1-(4-c...

Compound Q&A

What industries use 5-(4-Chlorophenyl)-1H-pyrrolo[2,3-B]pyridine (CAS: 918516-27-5)?

5-(4-Chlorophenyl)-1H-pyrrolo[2,3-B]pyridine is primarily used in the pharmaceutical industry as an ...

Compound Q&A

What precautions should be taken when handling 5-(4-Chlorophenyl)-1H-pyrrolo[2,3-B]pyridine (CAS: 918516-27-5)?

When handling 5-(4-Chlorophenyl)-1H-pyrrolo[2,3-B]pyridine, it is essential to use proper personal p...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...