Compound Q&A

What industries use Ethyl 4-[(2-amino-4-chlorophenyl)amino]-1-piperidinecarboxylate (CAS: 53786-45-1)?

Answer

Ethyl 4-[(2-amino-4-chlorophenyl)amino]-1-piperidinecarboxylate
Ethyl 4-[(2-amino-4-chlorophenyl)amino]-1-piperidinecarboxylate (CAS: 53786-45-1) is primarily used in the pharmaceutical industry for the synthesis of various drugs. It also finds applications in the sensor technology and semiconductor industries due to its specific chemical properties. In polymer science, it can be used as a functional monomer or additive.

About

CAS No 53786-45-1
English Name Ethyl 4-[(2-amino-4-chlorophenyl)amino]-1-piperidinecarboxylate
Molecular Formula C14H20ClN3O2
Molecular Weight 297.79 g/mol
SMILES CCOC(=O)N1CCC(CC1)NC2=C(C=C(C=C2)Cl)N
InChIKey PPCPQDDCMQRJLS-UHFFFAOYSA-N
Last Updated: 2025-10-20 00:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl 4-[(2-amino-4-chlorophenyl)amino]-1-piperidinecarboxylate (CAS: 53786-45-1)?

Ethyl 4-[(2-amino-4-chlorophenyl)amino]-1-piperidinecarboxylate (CAS: 53786-45-1) is a white to off-...

Compound Q&A

How is Ethyl 4-[(2-amino-4-chlorophenyl)amino]-1-piperidinecarboxylate (CAS: 53786-45-1) typically synthesized?

Ethyl 4-[(2-amino-4-chlorophenyl)amino]-1-piperidinecarboxylate (CAS: 53786-45-1) is typically synth...

Compound Q&A

What precautions should be taken when handling Ethyl 4-[(2-amino-4-chlorophenyl)amino]-1-piperidinecarboxylate (CAS: 53786-45-1)?

When handling Ethyl 4-[(2-amino-4-chlorophenyl)amino]-1-piperidinecarboxylate (CAS: 53786-45-1), it ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...