Compound Q&A

How is Ethyl 4-[(2-amino-4-chlorophenyl)amino]-1-piperidinecarboxylate (CAS: 53786-45-1) typically synthesized?

Answer

Ethyl 4-[(2-amino-4-chlorophenyl)amino]-1-piperidinecarboxylate
Ethyl 4-[(2-amino-4-chlorophenyl)amino]-1-piperidinecarboxylate (CAS: 53786-45-1) is typically synthesized through a multi-step process involving the reaction of 2-amino-4-chloroaniline with 1-aminopiperidine-4-carboxylic acid ethyl ester. The synthesis involves the formation of an intermediate amine compound followed by piperidine substitution to yield the final product. The process requires careful control over temperature and pH to achieve high selectivity and yield.

About

CAS No 53786-45-1
English Name Ethyl 4-[(2-amino-4-chlorophenyl)amino]-1-piperidinecarboxylate
Molecular Formula C14H20ClN3O2
Molecular Weight 297.79 g/mol
SMILES CCOC(=O)N1CCC(CC1)NC2=C(C=C(C=C2)Cl)N
InChIKey PPCPQDDCMQRJLS-UHFFFAOYSA-N
Last Updated: 2025-10-20 00:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl 4-[(2-amino-4-chlorophenyl)amino]-1-piperidinecarboxylate (CAS: 53786-45-1)?

Ethyl 4-[(2-amino-4-chlorophenyl)amino]-1-piperidinecarboxylate (CAS: 53786-45-1) is a white to off-...

Compound Q&A

What industries use Ethyl 4-[(2-amino-4-chlorophenyl)amino]-1-piperidinecarboxylate (CAS: 53786-45-1)?

Ethyl 4-[(2-amino-4-chlorophenyl)amino]-1-piperidinecarboxylate (CAS: 53786-45-1) is primarily used ...

Compound Q&A

What precautions should be taken when handling Ethyl 4-[(2-amino-4-chlorophenyl)amino]-1-piperidinecarboxylate (CAS: 53786-45-1)?

When handling Ethyl 4-[(2-amino-4-chlorophenyl)amino]-1-piperidinecarboxylate (CAS: 53786-45-1), it ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...