Compound Q&A

What industries use 2-Cyanobenzenesulfonyl chloride (CAS: 69360-26-5)?

Answer

2-Cyanobenzenesulfonyl chloride
2-Cyanobenzenesulfonyl chloride (CAS: 69360-26-5) is primarily used in the pharmaceutical industry for the synthesis of certain drug molecules. It is also utilized in the chemical industry for the preparation of polymers and in the electronic industry for the production of semiconductors and sensors.

About

CAS No 69360-26-5
English Name 2-Cyanobenzenesulfonyl chloride
Molecular Formula C7H4ClNO2S
Molecular Weight 190.65 g/mol
SMILES C1=CC=C(C(=C1)C#N)S(=O)(=O)Cl
InChIKey NQAYCMBZPAARNO-UHFFFAOYSA-N
Last Updated: 2025-10-20 00:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Cyanobenzenesulfonyl chloride (CAS: 69360-26-5)?

2-Cyanobenzenesulfonyl chloride (CAS: 69360-26-5) is a white crystalline solid with a molecular weig...

Compound Q&A

How is 2-Cyanobenzenesulfonyl chloride (CAS: 69360-26-5) typically synthesized?

2-Cyanobenzenesulfonyl chloride is typically synthesized via the chlorosulfonylation of 2-cyanobenze...

Compound Q&A

What precautions should be taken when handling 2-Cyanobenzenesulfonyl chloride (CAS: 69360-26-5)?

When handling 2-Cyanobenzenesulfonyl chloride (CAS: 69360-26-5), it is essential to wear appropriate...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...