Compound Q&A

What are the physical and chemical properties of 2-Cyanobenzenesulfonyl chloride (CAS: 69360-26-5)?

Answer

2-Cyanobenzenesulfonyl chloride
2-Cyanobenzenesulfonyl chloride (CAS: 69360-26-5) is a white crystalline solid with a molecular weight of approximately 246.14 g/mol. It is only slightly soluble in water but highly soluble in organic solvents like dichloromethane and ethanol. Chemically, it is a reactive compound, prone to nucleophilic substitution reactions and prone to hydrolysis under basic conditions.

About

CAS No 69360-26-5
English Name 2-Cyanobenzenesulfonyl chloride
Molecular Formula C7H4ClNO2S
Molecular Weight 190.65 g/mol
SMILES C1=CC=C(C(=C1)C#N)S(=O)(=O)Cl
InChIKey NQAYCMBZPAARNO-UHFFFAOYSA-N
Last Updated: 2025-10-20 00:35

Related Q&A

Compound Q&A

How is 2-Cyanobenzenesulfonyl chloride (CAS: 69360-26-5) typically synthesized?

2-Cyanobenzenesulfonyl chloride is typically synthesized via the chlorosulfonylation of 2-cyanobenze...

Compound Q&A

What industries use 2-Cyanobenzenesulfonyl chloride (CAS: 69360-26-5)?

2-Cyanobenzenesulfonyl chloride (CAS: 69360-26-5) is primarily used in the pharmaceutical industry f...

Compound Q&A

What precautions should be taken when handling 2-Cyanobenzenesulfonyl chloride (CAS: 69360-26-5)?

When handling 2-Cyanobenzenesulfonyl chloride (CAS: 69360-26-5), it is essential to wear appropriate...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...