Compound Q&A

What industries use 4-Nitrophenyl 6-deoxy-alpha-L-mannopyranoside (CAS: 18918-31-5)?

Answer

4-Nitrophenyl 6-deoxy-alpha-L-mannopyranoside
4-Nitrophenyl 6-deoxy-alpha-L-mannopyranoside (CAS: 18918-31-5) is primarily used in the pharmaceutical industry for the synthesis of various bioactive compounds. It also has applications in organic chemistry as a building block for natural product synthesis and in polymer chemistry for the development of specialized polymers. Additionally, it can be used in sensor technology for the detection of specific chemical compounds.

About

CAS No 18918-31-5
English Name 4-Nitrophenyl 6-deoxy-alpha-L-mannopyranoside
Molecular Formula C12H15NO7
Molecular Weight 285.25 g/mol
SMILES CC1C(C(C(C(O1)OC2=CC=C(C=C2)[N+](=O)[O-])O)O)O
InChIKey YILIDCGSXCGACV-UOAXWKJLSA-N
Last Updated: 2025-10-20 00:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Nitrophenyl 6-deoxy-alpha-L-mannopyranoside (CAS: 18918-31-5)?

4-Nitrophenyl 6-deoxy-alpha-L-mannopyranoside (CAS: 18918-31-5) is a white crystalline solid with a ...

Compound Q&A

How is 4-Nitrophenyl 6-deoxy-alpha-L-mannopyranoside (CAS: 18918-31-5) typically synthesized?

4-Nitrophenyl 6-deoxy-alpha-L-mannopyranoside is typically synthesized through the condensation reac...

Compound Q&A

What precautions should be taken when handling 4-Nitrophenyl 6-deoxy-alpha-L-mannopyranoside (CAS: 18918-31-5)?

When handling 4-Nitrophenyl 6-deoxy-alpha-L-mannopyranoside (CAS: 18918-31-5), gloves, goggles, and ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...