Compound Q&A

What are the physical and chemical properties of 4-Nitrophenyl 6-deoxy-alpha-L-mannopyranoside (CAS: 18918-31-5)?

Answer

4-Nitrophenyl 6-deoxy-alpha-L-mannopyranoside
4-Nitrophenyl 6-deoxy-alpha-L-mannopyranoside (CAS: 18918-31-5) is a white crystalline solid with a molecular weight of approximately 347.12 g/mol. It has low solubility in water but is more soluble in organic solvents like methanol and ethanol. This compound is known for its reactivity, particularly towards nucleophiles and reducing agents, making it useful in organic synthesis.

About

CAS No 18918-31-5
English Name 4-Nitrophenyl 6-deoxy-alpha-L-mannopyranoside
Molecular Formula C12H15NO7
Molecular Weight 285.25 g/mol
SMILES CC1C(C(C(C(O1)OC2=CC=C(C=C2)[N+](=O)[O-])O)O)O
InChIKey YILIDCGSXCGACV-UOAXWKJLSA-N
Last Updated: 2025-10-20 00:35

Related Q&A

Compound Q&A

How is 4-Nitrophenyl 6-deoxy-alpha-L-mannopyranoside (CAS: 18918-31-5) typically synthesized?

4-Nitrophenyl 6-deoxy-alpha-L-mannopyranoside is typically synthesized through the condensation reac...

Compound Q&A

What industries use 4-Nitrophenyl 6-deoxy-alpha-L-mannopyranoside (CAS: 18918-31-5)?

4-Nitrophenyl 6-deoxy-alpha-L-mannopyranoside (CAS: 18918-31-5) is primarily used in the pharmaceuti...

Compound Q&A

What precautions should be taken when handling 4-Nitrophenyl 6-deoxy-alpha-L-mannopyranoside (CAS: 18918-31-5)?

When handling 4-Nitrophenyl 6-deoxy-alpha-L-mannopyranoside (CAS: 18918-31-5), gloves, goggles, and ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...