Compound Q&A

What industries use 1-tert-butyl-3-(p-tolyl)pyrazolo[3,4-d]pyrimidin-4-amine (CAS: 172889-26-8)?

Answer

1-tert-butyl-3-(p-tolyl)pyrazolo[3,4-d]pyrimidin-4-amine
1-tert-butyl-3-(p-tolyl)pyrazolo[3,4-d]pyrimidin-4-amine is primarily used in the pharmaceutical industry for the development of novel drugs. It also finds applications in the polymer industry for the synthesis of functional polymers and in the sensor industry for the production of chemical sensors. Its unique properties make it suitable for these industries where high performance and stability are required.

About

English Name 1-tert-butyl-3-(p-tolyl)pyrazolo[3,4-d]pyrimidin-4-amine
Molecular Formula C16H19N5
Molecular Weight 281.36 g/mol
SMILES Cc1ccc(cc1)c1nn(c2c1c(N)ncn2)C(C)(C)C
InChIKey ZVPDNRVYHLRXLX-UHFFFAOYSA-N
Last Updated: 2025-10-20 00:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-tert-butyl-3-(p-tolyl)pyrazolo[3,4-d]pyrimidin-4-amine (CAS: 172889-26-8)?

1-tert-butyl-3-(p-tolyl)pyrazolo[3,4-d]pyrimidin-4-amine is a solid crystalline compound with a mole...

Compound Q&A

How is 1-tert-butyl-3-(p-tolyl)pyrazolo[3,4-d]pyrimidin-4-amine (CAS: 172889-26-8) typically synthesized?

1-tert-butyl-3-(p-tolyl)pyrazolo[3,4-d]pyrimidin-4-amine is typically synthesized through a multi-st...

Compound Q&A

What precautions should be taken when handling 1-tert-butyl-3-(p-tolyl)pyrazolo[3,4-d]pyrimidin-4-amine (CAS: 172889-26-8)?

When handling 1-tert-butyl-3-(p-tolyl)pyrazolo[3,4-d]pyrimidin-4-amine, it is important to wear appr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...