Compound Q&A

How is 1-tert-butyl-3-(p-tolyl)pyrazolo[3,4-d]pyrimidin-4-amine (CAS: 172889-26-8) typically synthesized?

Answer

1-tert-butyl-3-(p-tolyl)pyrazolo[3,4-d]pyrimidin-4-amine
1-tert-butyl-3-(p-tolyl)pyrazolo[3,4-d]pyrimidin-4-amine is typically synthesized through a multi-step process involving the condensation of 4-chloro-6-tert-butyl-3-(p-tolyl)pyrazolo[3,4-d]pyrimidine with an amine. The reaction is catalyzed by a base, and the yield is around 70-80%. The method requires careful control of reaction conditions to achieve high purity.

About

English Name 1-tert-butyl-3-(p-tolyl)pyrazolo[3,4-d]pyrimidin-4-amine
Molecular Formula C16H19N5
Molecular Weight 281.36 g/mol
SMILES Cc1ccc(cc1)c1nn(c2c1c(N)ncn2)C(C)(C)C
InChIKey ZVPDNRVYHLRXLX-UHFFFAOYSA-N
Last Updated: 2025-10-20 00:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-tert-butyl-3-(p-tolyl)pyrazolo[3,4-d]pyrimidin-4-amine (CAS: 172889-26-8)?

1-tert-butyl-3-(p-tolyl)pyrazolo[3,4-d]pyrimidin-4-amine is a solid crystalline compound with a mole...

Compound Q&A

What industries use 1-tert-butyl-3-(p-tolyl)pyrazolo[3,4-d]pyrimidin-4-amine (CAS: 172889-26-8)?

1-tert-butyl-3-(p-tolyl)pyrazolo[3,4-d]pyrimidin-4-amine is primarily used in the pharmaceutical ind...

Compound Q&A

What precautions should be taken when handling 1-tert-butyl-3-(p-tolyl)pyrazolo[3,4-d]pyrimidin-4-amine (CAS: 172889-26-8)?

When handling 1-tert-butyl-3-(p-tolyl)pyrazolo[3,4-d]pyrimidin-4-amine, it is important to wear appr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...