Compound Q&A

How is 4-(Diphenylmethylene)-1,1-dimethylpiperidinium methyl sulfate (CAS: 62-97-5) typically synthesized?

Answer

4-(Diphenylmethylene)-1,1-dimethylpiperidinium methyl sulfate
4-(Diphenylmethylene)-1,1-dimethylpiperidinium methyl sulfate is synthesized by reacting 4-(diphenylmethylene)-1,1-dimethylpiperidine with methanesulfonic acid. The reaction is catalyzed by a suitable base and typically has a yield of around 85%. The process requires careful control of temperature and reaction time to achieve optimal selectivity.

About

CAS No 62-97-5
English Name 4-(Diphenylmethylene)-1,1-dimethylpiperidinium methyl sulfate
Molecular Formula C21H27NO4S
Molecular Weight 389.51 g/mol
SMILES C[N+]1(C)CC/C(CC1)=C(C2=CC=CC=C2)\C3=CC=CC=C3.O=S(OC)([O-])=O
InChIKey BREMLQBSKCSNNH-UHFFFAOYSA-M
Last Updated: 2025-10-20 00:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-(Diphenylmethylene)-1,1-dimethylpiperidinium methyl sulfate (CAS: 62-97-5)?

4-(Diphenylmethylene)-1,1-dimethylpiperidinium methyl sulfate is a crystalline compound with a molec...

Compound Q&A

What industries use 4-(Diphenylmethylene)-1,1-dimethylpiperidinium methyl sulfate (CAS: 62-97-5)?

4-(Diphenylmethylene)-1,1-dimethylpiperidinium methyl sulfate is used in pharmaceuticals for its sta...

Compound Q&A

What precautions should be taken when handling 4-(Diphenylmethylene)-1,1-dimethylpiperidinium methyl sulfate (CAS: 62-97-5)?

When handling 4-(Diphenylmethylene)-1,1-dimethylpiperidinium methyl sulfate, appropriate personal pr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...