Compound Q&A

What are the physical and chemical properties of 4-(Diphenylmethylene)-1,1-dimethylpiperidinium methyl sulfate (CAS: 62-97-5)?

Answer

4-(Diphenylmethylene)-1,1-dimethylpiperidinium methyl sulfate
4-(Diphenylmethylene)-1,1-dimethylpiperidinium methyl sulfate is a crystalline compound with a molecular weight of approximately 492.47 g/mol. It is slightly soluble in water and has good solubility in organic solvents. Chemically, it is stable under normal conditions but can react with strong acids and bases. It is used in various applications requiring its unique physicochemical properties.

About

CAS No 62-97-5
English Name 4-(Diphenylmethylene)-1,1-dimethylpiperidinium methyl sulfate
Molecular Formula C21H27NO4S
Molecular Weight 389.51 g/mol
SMILES C[N+]1(C)CC/C(CC1)=C(C2=CC=CC=C2)\C3=CC=CC=C3.O=S(OC)([O-])=O
InChIKey BREMLQBSKCSNNH-UHFFFAOYSA-M
Last Updated: 2025-10-20 00:35

Related Q&A

Compound Q&A

How is 4-(Diphenylmethylene)-1,1-dimethylpiperidinium methyl sulfate (CAS: 62-97-5) typically synthesized?

4-(Diphenylmethylene)-1,1-dimethylpiperidinium methyl sulfate is synthesized by reacting 4-(diphenyl...

Compound Q&A

What industries use 4-(Diphenylmethylene)-1,1-dimethylpiperidinium methyl sulfate (CAS: 62-97-5)?

4-(Diphenylmethylene)-1,1-dimethylpiperidinium methyl sulfate is used in pharmaceuticals for its sta...

Compound Q&A

What precautions should be taken when handling 4-(Diphenylmethylene)-1,1-dimethylpiperidinium methyl sulfate (CAS: 62-97-5)?

When handling 4-(Diphenylmethylene)-1,1-dimethylpiperidinium methyl sulfate, appropriate personal pr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...