Compound Q&A

What precautions should be taken when handling Ganoderic acid C1 (CAS: 95311-97-0)?

Answer

Ganoderic acid C1
When handling Ganoderic acid C1 (CAS: 95311-97-0), it is crucial to wear appropriate personal protective equipment (PPE) such as gloves and safety goggles. Store in a cool, dry place away from heat and light. In case of spill, use a fume hood and follow standard safety protocols. Always refer to the Safety Data Sheet (SDS) for detailed safety information.

About

CAS No 95311-97-0
English Name Ganoderic acid C1
Molecular Formula C30H42O7
Molecular Weight 514.65 g/mol
SMILES O=C(C[C@H](C(=O)O)C)C[C@H]([C@H]1CC(=O)[C@@]2([C@]1(C)CC(=O)C1=C2[C@@H](O)C[C@@H]2[C@]1(C)CCC(=O)C2(C)C)C)C
InChIKey YTVGSCZIHGRVAV-NJNFCIENSA-N
Last Updated: 2025-10-20 00:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ganoderic acid C1 (CAS: 95311-97-0)?

Ganoderic acid C1 (CAS: 95311-97-0) is a crystalline compound with a molecular weight of approximate...

Compound Q&A

How is Ganoderic acid C1 (CAS: 95311-97-0) typically synthesized?

Ganoderic acid C1 (CAS: 95311-97-0) is synthesized through a multi-step process involving chemical r...

Compound Q&A

What industries use Ganoderic acid C1 (CAS: 95311-97-0)?

Ganoderic acid C1 (CAS: 95311-97-0) is primarily used in the pharmaceutical industry for its potenti...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...