Compound Q&A

What industries use Ganoderic acid C1 (CAS: 95311-97-0)?

Answer

Ganoderic acid C1
Ganoderic acid C1 (CAS: 95311-97-0) is primarily used in the pharmaceutical industry for its potential medicinal properties. It is also utilized in the cosmetics industry for its skincare benefits and in research applications for its bioactivity.

About

CAS No 95311-97-0
English Name Ganoderic acid C1
Molecular Formula C30H42O7
Molecular Weight 514.65 g/mol
SMILES O=C(C[C@H](C(=O)O)C)C[C@H]([C@H]1CC(=O)[C@@]2([C@]1(C)CC(=O)C1=C2[C@@H](O)C[C@@H]2[C@]1(C)CCC(=O)C2(C)C)C)C
InChIKey YTVGSCZIHGRVAV-NJNFCIENSA-N
Last Updated: 2025-10-20 00:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ganoderic acid C1 (CAS: 95311-97-0)?

Ganoderic acid C1 (CAS: 95311-97-0) is a crystalline compound with a molecular weight of approximate...

Compound Q&A

How is Ganoderic acid C1 (CAS: 95311-97-0) typically synthesized?

Ganoderic acid C1 (CAS: 95311-97-0) is synthesized through a multi-step process involving chemical r...

Compound Q&A

What precautions should be taken when handling Ganoderic acid C1 (CAS: 95311-97-0)?

When handling Ganoderic acid C1 (CAS: 95311-97-0), it is crucial to wear appropriate personal protec...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...