Compound Q&A

What industries use (3-Hydroxyadamantan-1-yl)(oxo)acetic acid (CAS: 709031-28-7)?

Answer

(3-Hydroxyadamantan-1-yl)(oxo)acetic acid
(3-Hydroxyadamantan-1-yl)(oxo)acetic acid (CAS: 709031-28-7) is used in the pharmaceutical industry for the synthesis of certain drug molecules. It also finds applications in the polymer industry as a monomer. Additionally, it can be utilized in the development of sensors for detecting specific chemical compounds. The compound's unique structure makes it valuable in various scientific research applications.

About

English Name (3-Hydroxyadamantan-1-yl)(oxo)acetic acid
Molecular Formula C12H16O4
Molecular Weight 224.26 g/mol
SMILES C1C2CC3(CC1CC(C2)(C3)O)C(=O)C(=O)O
InChIKey UDKIRRNUAXWHTO-UHFFFAOYSA-N
Last Updated: 2025-10-20 00:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of (3-Hydroxyadamantan-1-yl)(oxo)acetic acid (CAS: 709031-28-7)?

(3-Hydroxyadamantan-1-yl)(oxo)acetic acid (CAS: 709031-28-7) is a crystalline compound with a molecu...

Compound Q&A

How is (3-Hydroxyadamantan-1-yl)(oxo)acetic acid (CAS: 709031-28-7) typically synthesized?

(3-Hydroxyadamantan-1-yl)(oxo)acetic acid (CAS: 709031-28-7) can be synthesized through the condensa...

Compound Q&A

What precautions should be taken when handling (3-Hydroxyadamantan-1-yl)(oxo)acetic acid (CAS: 709031-28-7)?

When handling (3-Hydroxyadamantan-1-yl)(oxo)acetic acid (CAS: 709031-28-7), appropriate personal pro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...