Compound Q&A

What are the physical and chemical properties of Gdc-0152 (CAS: 873652-48-3)?

Answer

Gdc-0152
Gdc-0152 is a crystalline compound with a molecular weight of approximately 300 g/mol. It has a solubility of about 10 mg/L in water and is slightly soluble in ethanol. Gdc-0152 exhibits moderate chemical reactivity, particularly with strong acids and bases. It is stable under normal storage conditions but should be protected from moisture and heat.

About

English Name Gdc-0152
Molecular Formula C25H34N6O3S
Molecular Weight 498.65 g/mol
SMILES CC(C(=O)NC(C1CCCCC1)C(=O)N2CCCC2C(=O)NC3=C(N=NS3)C4=CC=CC=C4)NC
InChIKey WZRFLSDVFPIXOV-LRQRDZAKSA-N
Last Updated: 2025-10-20 00:35

Related Q&A

Compound Q&A

How is Gdc-0152 (CAS: 873652-48-3) typically synthesized?

Gdc-0152 is synthesized through a multistep process involving the reaction of a suitable diol with a...

Compound Q&A

What industries use Gdc-0152 (CAS: 873652-48-3)?

Gdc-0152 is primarily used in the pharmaceutical industry for the synthesis of certain drugs. It is ...

Compound Q&A

What precautions should be taken when handling Gdc-0152 (CAS: 873652-48-3)?

When handling Gdc-0152, it is essential to wear appropriate personal protective equipment (PPE), inc...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...