Compound Q&A

What are the physical and chemical properties of (3S)-2,3,4,9-Tetrahydro-1H-beta-carboline-3-carboxylic acid (CAS: 42438-90-4)?

Answer

(3S)-2,3,4,9-Tetrahydro-1H-beta-carboline-3-carboxylic acid
(3S)-2,3,4,9-Tetrahydro-1H-beta-carboline-3-carboxylic acid is a crystalline solid with a molecular weight of approximately 203.17 g/mol. It is poorly soluble in water but soluble in organic solvents like ethanol and acetone. The compound exhibits basic properties due to the carboxylic acid group and beta-carboline ring system. It is chemically stable under normal conditions but may degrade under strongly acidic or basic environments.

About

CAS No 42438-90-4
English Name (3S)-2,3,4,9-Tetrahydro-1H-beta-carboline-3-carboxylic acid
Molecular Formula C12H12N2O2
Molecular Weight 216.24 g/mol
SMILES C1C(NCC2=C1C3=CC=CC=C3N2)C(=O)O
InChIKey FSNCEEGOMTYXKY-JTQLQIEISA-N
Last Updated: 2025-10-20 00:35

Related Q&A

Compound Q&A

How is (3S)-2,3,4,9-Tetrahydro-1H-beta-carboline-3-carboxylic acid (CAS: 42438-90-4) typically synthesized?

(3S)-2,3,4,9-Tetrahydro-1H-beta-carboline-3-carboxylic acid can be synthesized through various route...

Compound Q&A

What industries use (3S)-2,3,4,9-Tetrahydro-1H-beta-carboline-3-carboxylic acid (CAS: 42438-90-4)?

(3S)-2,3,4,9-Tetrahydro-1H-beta-carboline-3-carboxylic acid finds applications in pharmaceuticals, w...

Compound Q&A

What precautions should be taken when handling (3S)-2,3,4,9-Tetrahydro-1H-beta-carboline-3-carboxylic acid (CAS: 42438-90-4)?

When handling (3S)-2,3,4,9-Tetrahydro-1H-beta-carboline-3-carboxylic acid, it is essential to wear a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...