Compound Q&A

What are the physical and chemical properties of 1-[(4-Methylphenyl)sulfonyl]-1H-1,2,4-triazole (CAS: 13578-51-3)?

Answer

1-[(4-Methylphenyl)sulfonyl]-1H-1,2,4-triazole
1-[(4-Methylphenyl)sulfonyl]-1H-1,2,4-triazole (CAS: 13578-51-3) is a crystalline compound with a molecular weight of approximately 284.29 g/mol. It is slightly soluble in water but more soluble in organic solvents such as ethanol and acetone. This compound is known to be thermally stable and has good chemical stability, which makes it suitable for various applications in industry and research. Its reactivity is moderate, and it can undergo substitution reactions under certain conditions.

About

CAS No 13578-51-3
English Name 1-[(4-Methylphenyl)sulfonyl]-1H-1,2,4-triazole
Molecular Formula C9H9N3O2S
Molecular Weight 223.26 g/mol
SMILES CC1=CC=C(C=C1)S(=O)(=O)N2C=NC=N2
InChIKey GFWABQNSSIQCLB-UHFFFAOYSA-N
Last Updated: 2025-10-20 00:35

Related Q&A

Compound Q&A

How is 1-[(4-Methylphenyl)sulfonyl]-1H-1,2,4-triazole (CAS: 13578-51-3) typically synthesized?

1-[(4-Methylphenyl)sulfonyl]-1H-1,2,4-triazole (CAS: 13578-51-3) can be synthesized through a multis...

Compound Q&A

What industries use 1-[(4-Methylphenyl)sulfonyl]-1H-1,2,4-triazole (CAS: 13578-51-3)?

1-[(4-Methylphenyl)sulfonyl]-1H-1,2,4-triazole (CAS: 13578-51-3) finds applications in several indus...

Compound Q&A

What precautions should be taken when handling 1-[(4-Methylphenyl)sulfonyl]-1H-1,2,4-triazole (CAS: 13578-51-3)?

When handling 1-[(4-Methylphenyl)sulfonyl]-1H-1,2,4-triazole (CAS: 13578-51-3), it is essential to f...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...