Compound Q&A

What are the physical and chemical properties of (17alpha)-17-Hydroxy-7-methyl-19-norpregn-5(10)-en-20-yn-3-one (CAS: 5630-53-5)?

Answer

(17alpha)-17-Hydroxy-7-methyl-19-norpregn-5(10)-en-20-yn-3-one
(17alpha)-17-Hydroxy-7-methyl-19-norpregn-5(10)-en-20-yn-3-one is a white to off-white crystalline solid with a molecular weight of approximately 330.46 g/mol. It has limited water solubility, typically requiring solvents like methanol or ethanol for dissolution. The compound is relatively stable under normal conditions but can degrade under acidic or basic conditions. It exhibits low reactivity towards common functional groups but can undergo reactions such as reduction or aromatization with appropriate reagents.

About

CAS No 5630-53-5
English Name (17alpha)-17-Hydroxy-7-methyl-19-norpregn-5(10)-en-20-yn-3-one
Molecular Formula C21H28O2
Molecular Weight 312.4 g/mol
SMILES CC1CC2=C(CCC(=O)C2)C3C1C4CCC(C4(CC3)C)(C#C)O
InChIKey WZDGZWOAQTVYBX-XOINTXKNSA-N
Last Updated: 2025-10-20 00:35

Related Q&A

Compound Q&A

How is (17alpha)-17-Hydroxy-7-methyl-19-norpregn-5(10)-en-20-yn-3-one (CAS: 5630-53-5) typically synthesized?

(17alpha)-17-Hydroxy-7-methyl-19-norpregn-5(10)-en-20-yn-3-one is commonly synthesized through a ser...

Compound Q&A

What industries use (17alpha)-17-Hydroxy-7-methyl-19-norpregn-5(10)-en-20-yn-3-one (CAS: 5630-53-5)?

(17alpha)-17-Hydroxy-7-methyl-19-norpregn-5(10)-en-20-yn-3-one is primarily used in the pharmaceutic...

Compound Q&A

What precautions should be taken when handling (17alpha)-17-Hydroxy-7-methyl-19-norpregn-5(10)-en-20-yn-3-one (CAS: 5630-53-5)?

When handling (17alpha)-17-Hydroxy-7-methyl-19-norpregn-5(10)-en-20-yn-3-one, it is essential to wea...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...