Compound Q&A

What industries use Dimethyl bicyclo[2.2.2]octane-4,1-dicarboxylate (CAS: 1459-96-7)?

Answer

Dimethyl bicyclo[2.2.2]octane-1,4-dicarboxylate
Dimethyl bicyclo[2.2.2]octane-4,1-dicarboxylate (CAS: 1459-96-7) is used in industries such as pharmaceuticals for the synthesis of certain drugs, polymers for enhancing properties of plastic materials, and sensors for detecting specific chemical compounds. Its applications in semiconductors are also emerging, although its role in this field is currently limited.

About

CAS No 1459-96-7
English Name Dimethyl bicyclo[2.2.2]octane-1,4-dicarboxylate
Molecular Formula C12H18O4
Molecular Weight 226.27 g/mol
SMILES COC(=O)C12CCC(CC1)(CC2)C(=O)OC
InChIKey HDOVTVDGSLEUSK-UHFFFAOYSA-N
Last Updated: 2025-10-20 00:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of Dimethyl bicyclo[2.2.2]octane-1,4-dicarboxylate (CAS: 1459-96-7)?

Dimethyl bicyclo[2.2.2]octane-1,4-dicarboxylate is a colorless solid with a crystalline form. Its mo...

Compound Q&A

How is Dimethyl bicyclo[2.2.2]octane-4,1-dicarboxylate (CAS: 1459-96-7) typically synthesized?

Dimethyl bicyclo[2.2.2]octane-4,1-dicarboxylate can be synthesized via a series of reactions involvi...

Compound Q&A

What precautions should be taken when handling Dimethyl bicyclo[2.2.2]octane-4,1-dicarboxylate (CAS: 1459-96-7)?

When handling Dimethyl bicyclo[2.2.2]octane-4,1-dicarboxylate, it is crucial to wear appropriate per...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...