Compound Q&A

How is Dimethyl bicyclo[2.2.2]octane-4,1-dicarboxylate (CAS: 1459-96-7) typically synthesized?

Answer

Dimethyl bicyclo[2.2.2]octane-1,4-dicarboxylate
Dimethyl bicyclo[2.2.2]octane-4,1-dicarboxylate can be synthesized via a series of reactions involving the conversion of an alkene to a dicarboxylic acid ester. Commonly, this involves the reaction of bicyclo[2.2.2]octane with maleic anhydride and a catalyst like pyridine. The process typically yields high selectivity and good yield under optimized conditions, though careful handling is required to minimize side reactions.

About

CAS No 1459-96-7
English Name Dimethyl bicyclo[2.2.2]octane-1,4-dicarboxylate
Molecular Formula C12H18O4
Molecular Weight 226.27 g/mol
SMILES COC(=O)C12CCC(CC1)(CC2)C(=O)OC
InChIKey HDOVTVDGSLEUSK-UHFFFAOYSA-N
Last Updated: 2025-10-20 00:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of Dimethyl bicyclo[2.2.2]octane-1,4-dicarboxylate (CAS: 1459-96-7)?

Dimethyl bicyclo[2.2.2]octane-1,4-dicarboxylate is a colorless solid with a crystalline form. Its mo...

Compound Q&A

What industries use Dimethyl bicyclo[2.2.2]octane-4,1-dicarboxylate (CAS: 1459-96-7)?

Dimethyl bicyclo[2.2.2]octane-4,1-dicarboxylate (CAS: 1459-96-7) is used in industries such as pharm...

Compound Q&A

What precautions should be taken when handling Dimethyl bicyclo[2.2.2]octane-4,1-dicarboxylate (CAS: 1459-96-7)?

When handling Dimethyl bicyclo[2.2.2]octane-4,1-dicarboxylate, it is crucial to wear appropriate per...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...