Compound Q&A

What industries use tert-butyl 3-amino-3-(hydroxymethyl)pyrrolidine-1-carboxylate (CAS: 889949-18-2)?

Answer

Tert-butyl 3-amino-3-(hydroxymethyl)pyrrolidine-1-carboxylate
Tert-butyl 3-amino-3-(hydroxymethyl)pyrrolidine-1-carboxylate finds applications in various industries, including pharmaceuticals, where it serves as a building block in the synthesis of complex molecules. It is also used in the development of sensor materials for detecting specific chemicals. Additionally, it has potential uses in the polymer industry for modifying material properties and in semiconductor manufacturing for etching processes.

About

English Name Tert-butyl 3-amino-3-(hydroxymethyl)pyrrolidine-1-carboxylate
Molecular Formula C10H20N2O3
Molecular Weight 216.28 g/mol
SMILES CC(C)(C)OC(=O)N1CCC(C1)(CO)N
InChIKey BAMSJMDJDXMZDC-UHFFFAOYSA-N
Last Updated: 2025-10-20 00:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of tert-butyl 3-amino-3-(hydroxymethyl)pyrrolidine-1-carboxylate (CAS: 889949-18-2)?

Tert-butyl 3-amino-3-(hydroxymethyl)pyrrolidine-1-carboxylate is a white or off-white crystalline so...

Compound Q&A

How is tert-butyl 3-amino-3-(hydroxymethyl)pyrrolidine-1-carboxylate (CAS: 889949-18-2) typically synthesized?

Tert-butyl 3-amino-3-(hydroxymethyl)pyrrolidine-1-carboxylate can be synthesized via a multistep pro...

Compound Q&A

What precautions should be taken when handling tert-butyl 3-amino-3-(hydroxymethyl)pyrrolidine-1-carboxylate (CAS: 889949-18-2)?

When handling tert-butyl 3-amino-3-(hydroxymethyl)pyrrolidine-1-carboxylate, it is essential to use ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...