Compound Q&A

What are the physical and chemical properties of tert-butyl 3-amino-3-(hydroxymethyl)pyrrolidine-1-carboxylate (CAS: 889949-18-2)?

Answer

Tert-butyl 3-amino-3-(hydroxymethyl)pyrrolidine-1-carboxylate
Tert-butyl 3-amino-3-(hydroxymethyl)pyrrolidine-1-carboxylate is a white or off-white crystalline solid with a molecular weight of approximately 246.32 g/mol. It has a high solubility in water and organic solvents. Chemically, it is highly reactive due to the presence of amino and hydroxyl groups, making it susceptible to nucleophilic and electrophilic reactions. The compound is stable under normal conditions but should be stored away from strong acids and bases.

About

English Name Tert-butyl 3-amino-3-(hydroxymethyl)pyrrolidine-1-carboxylate
Molecular Formula C10H20N2O3
Molecular Weight 216.28 g/mol
SMILES CC(C)(C)OC(=O)N1CCC(C1)(CO)N
InChIKey BAMSJMDJDXMZDC-UHFFFAOYSA-N
Last Updated: 2025-10-20 00:35

Related Q&A

Compound Q&A

How is tert-butyl 3-amino-3-(hydroxymethyl)pyrrolidine-1-carboxylate (CAS: 889949-18-2) typically synthesized?

Tert-butyl 3-amino-3-(hydroxymethyl)pyrrolidine-1-carboxylate can be synthesized via a multistep pro...

Compound Q&A

What industries use tert-butyl 3-amino-3-(hydroxymethyl)pyrrolidine-1-carboxylate (CAS: 889949-18-2)?

Tert-butyl 3-amino-3-(hydroxymethyl)pyrrolidine-1-carboxylate finds applications in various industri...

Compound Q&A

What precautions should be taken when handling tert-butyl 3-amino-3-(hydroxymethyl)pyrrolidine-1-carboxylate (CAS: 889949-18-2)?

When handling tert-butyl 3-amino-3-(hydroxymethyl)pyrrolidine-1-carboxylate, it is essential to use ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...