Compound Q&A

What industries use tert-butyl (3S)-3-methyl-1,4-diazepane-1-carboxylate (CAS: 194032-32-1)?

Answer

tert-butyl (3S)-3-methyl-1,4-diazepane-1-carboxylate
This compound is primarily used in the pharmaceutical industry for the synthesis of various drugs. It is also employed in the polymer industry as a monomer for developing new materials. Additionally, it has applications in the semiconductor industry for certain sensors and as a chemical intermediate.

About

English Name tert-butyl (3S)-3-methyl-1,4-diazepane-1-carboxylate
Molecular Formula C11H22N2O2
Molecular Weight 214.31 g/mol
SMILES C[C@@H]1NCCCN(C1)C(=O)OC(C)(C)C
InChIKey GDTFCUXOVITPHU-VIFPVBQESA-N
Last Updated: 2025-10-20 00:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of tert-butyl (3S)-3-methyl-1,4-diazepane-1-carboxylate (CAS: 194032-32-1)?

The compound is a white solid with a crystalline form. The molecular weight is approximately 219.33 ...

Compound Q&A

How is tert-butyl (3S)-3-methyl-1,4-diazepane-1-carboxylate (CAS: 194032-32-1) typically synthesized?

Tert-butyl (3S)-3-methyl-1,4-diazepane-1-carboxylate can be synthesized through a multi-step process...

Compound Q&A

What precautions should be taken when handling tert-butyl (3S)-3-methyl-1,4-diazepane-1-carboxylate (CAS: 194032-32-1)?

When handling tert-butyl (3S)-3-methyl-1,4-diazepane-1-carboxylate, it is essential to wear proper p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...