Compound Q&A

What are the physical and chemical properties of tert-butyl (3S)-3-methyl-1,4-diazepane-1-carboxylate (CAS: 194032-32-1)?

Answer

tert-butyl (3S)-3-methyl-1,4-diazepane-1-carboxylate
The compound is a white solid with a crystalline form. The molecular weight is approximately 219.33 g/mol. It has a low solubility in water but is soluble in organic solvents like methanol and dichloromethane. Chemically, it is stable under normal conditions but can react with strong bases. It is used in organic synthesis and pharmaceuticals due to its reactivity and functional groups.

About

English Name tert-butyl (3S)-3-methyl-1,4-diazepane-1-carboxylate
Molecular Formula C11H22N2O2
Molecular Weight 214.31 g/mol
SMILES C[C@@H]1NCCCN(C1)C(=O)OC(C)(C)C
InChIKey GDTFCUXOVITPHU-VIFPVBQESA-N
Last Updated: 2025-10-20 00:35

Related Q&A

Compound Q&A

How is tert-butyl (3S)-3-methyl-1,4-diazepane-1-carboxylate (CAS: 194032-32-1) typically synthesized?

Tert-butyl (3S)-3-methyl-1,4-diazepane-1-carboxylate can be synthesized through a multi-step process...

Compound Q&A

What industries use tert-butyl (3S)-3-methyl-1,4-diazepane-1-carboxylate (CAS: 194032-32-1)?

This compound is primarily used in the pharmaceutical industry for the synthesis of various drugs. I...

Compound Q&A

What precautions should be taken when handling tert-butyl (3S)-3-methyl-1,4-diazepane-1-carboxylate (CAS: 194032-32-1)?

When handling tert-butyl (3S)-3-methyl-1,4-diazepane-1-carboxylate, it is essential to wear proper p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...